C17H15BrN4O2S — CID 15783145
N'-[2-(1H-benzimidazol-2-ylsulfanyl)propanoyl]-4-bromobenzohydrazide (PubChem CID 15783145) has the molecular formula C17H15BrN4O2S and a molecular weight of 419.30 g/mol. Its IUPAC name is N'-[2-(1H-benzimidazol-2-ylsulfanyl)propanoyl]-4-bromobenzohydrazide.
| Compound Name | N'-[2-(1H-benzimidazol-2-ylsulfanyl)propanoyl]-4-bromobenzohydrazide |
|---|---|
| PubChem CID | 15783145 |
| Molecular Formula | C17H15BrN4O2S |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | N'-[2-(1H-benzimidazol-2-ylsulfanyl)propanoyl]-4-bromobenzohydrazide |
| SMILES | CC(Sc1nc2ccccc2[nH]1)C(=O)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrN4O2S/c1-10(25-17-19-13-4-2-3-5-14(13)20-17)15(23)21-22-16(24)11-6-8-12(18)9-7-11/h2-10H,1H3,(H,19,20)(H,21,23)(H,22,24) |
| InChIKey | MVXDYMJVBWBPTQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|