About (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate
(1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate (PubChem CID 15783235) has the molecular formula C13H14F3NO3S
and a molecular weight of 321.32 g/mol. Its IUPAC name is (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate |
| PubChem CID | 15783235 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=CCN(Cc2ccccc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO3S/c14-13(15,16)21(18,19)20-12-6-8-17(9-7-12)10-11-4-2-1-3-5-11/h1-6H,7-10H2 |
| InChIKey | NNFIKVJJWALOEG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate?
The IUPAC name of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate (CID 15783235) is (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate?
The canonical SMILES for (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate is O=S(=O)(OC1=CCN(Cc2ccccc2)CC1)C(F)(F)F.
What is the InChIKey of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate?
The InChIKey is NNFIKVJJWALOEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3NO3S/c14-13(15,16)21(18,19)20-12-6-8-17(9-7-12)10-11-4-2-1-3-5-11/h1-6H,7-10H2.
What are the key properties of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate?
(1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate has a molecular weight of 321.32 g/mol, XLogP of 2.64, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 15783235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).