About 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one
3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one (PubChem CID 15783486) has the molecular formula C10H18N2OS
and a molecular weight of 214.33 g/mol. Its IUPAC name is 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one.
Molecular Properties
| Compound Name | 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one |
| PubChem CID | 15783486 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one |
| SMILES | CCCCCC1SC(=O)N(C)N=C1C |
| InChI | InChI=1S/C10H18N2OS/c1-4-5-6-7-9-8(2)11-12(3)10(13)14-9/h9H,4-7H2,1-3H3 |
| InChIKey | BRNDDKHFCUIOPM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one?
The IUPAC name of 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one (CID 15783486) is 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one.
What is the SMILES notation for 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one?
The canonical SMILES for 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one is CCCCCC1SC(=O)N(C)N=C1C.
What is the InChIKey of 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one?
The InChIKey is BRNDDKHFCUIOPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2OS/c1-4-5-6-7-9-8(2)11-12(3)10(13)14-9/h9H,4-7H2,1-3H3.
What are the key properties of 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one?
3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one has a molecular weight of 214.33 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-6-pentyl-6H-1,3,4-thiadiazin-2-one is sourced from PubChem (CID 15783486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).