About 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline
2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline (PubChem CID 15783595) has the molecular formula C15H14N2O
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline.
Molecular Properties
| Compound Name | 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline |
| PubChem CID | 15783595 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline |
| SMILES | Nc1ccccc1C1=N[C@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C15H14N2O/c16-13-9-5-4-8-12(13)15-17-14(10-18-15)11-6-2-1-3-7-11/h1-9,14H,10,16H2/t14-/m0/s1 |
| InChIKey | USNRYBPPOQLMAB-AWEZNQCLSA-N |
| XLogP | 2.79 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline?
The IUPAC name of 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline (CID 15783595) is 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline.
What is the SMILES notation for 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline?
The canonical SMILES for 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline is Nc1ccccc1C1=N[C@H](c2ccccc2)CO1.
What is the InChIKey of 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline?
The InChIKey is USNRYBPPOQLMAB-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H14N2O/c16-13-9-5-4-8-12(13)15-17-14(10-18-15)11-6-2-1-3-7-11/h1-9,14H,10,16H2/t14-/m0/s1.
What are the key properties of 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline?
2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline has a molecular weight of 238.29 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline is sourced from PubChem (CID 15783595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).