C15H14N4O3 — CID 15783874
methyl N-[4-(6-amino-3-cyano-2-methoxy-4-pyridinyl)phenyl]carbamate (PubChem CID 15783874) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is methyl N-[4-(6-amino-3-cyano-2-methoxy-4-pyridinyl)phenyl]carbamate.
| Compound Name | methyl N-[4-(6-amino-3-cyano-2-methoxy-4-pyridinyl)phenyl]carbamate |
|---|---|
| PubChem CID | 15783874 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | methyl N-[4-(6-amino-3-cyano-2-methoxy-4-pyridinyl)phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(-c2cc(N)nc(OC)c2C#N)cc1 |
| InChI | InChI=1S/C15H14N4O3/c1-21-14-12(8-16)11(7-13(17)19-14)9-3-5-10(6-4-9)18-15(20)22-2/h3-7H,1-2H3,(H2,17,19)(H,18,20) |
| InChIKey | FLWQNDPLANPACP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |