About 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene
1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene (PubChem CID 15783912) has the molecular formula C14H16ClNO2
and a molecular weight of 265.74 g/mol. Its IUPAC name is 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene.
Molecular Properties
| Compound Name | 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene |
| PubChem CID | 15783912 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene |
| SMILES | CC1=C(C)C[C@H]([N+](=O)[O-])[C@@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C14H16ClNO2/c1-9-7-13(11-3-5-12(15)6-4-11)14(16(17)18)8-10(9)2/h3-6,13-14H,7-8H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | ZYCKELPHVZGGMH-KGLIPLIRSA-N |
| XLogP | 4.20 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene?
The IUPAC name of 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene (CID 15783912) is 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene.
What is the SMILES notation for 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene?
The canonical SMILES for 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene is CC1=C(C)C[C@H]([N+](=O)[O-])[C@@H](c2ccc(Cl)cc2)C1.
What is the InChIKey of 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene?
The InChIKey is ZYCKELPHVZGGMH-KGLIPLIRSA-N. The full InChI is InChI=1S/C14H16ClNO2/c1-9-7-13(11-3-5-12(15)6-4-11)14(16(17)18)8-10(9)2/h3-6,13-14H,7-8H2,1-2H3/t13-,14+/m1/s1.
What are the key properties of 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene?
1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene has a molecular weight of 265.74 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[(1R,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]benzene is sourced from PubChem (CID 15783912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).