C28H46OSi3 — CID 15784111
ditert-butyl-(3,3-dimethyl-1-phenyl-4-trimethylsilyl-4aH-2,3-benzoxasilin-4-yl)-methylsilane (PubChem CID 15784111) has the molecular formula C28H46OSi3 and a molecular weight of 482.93 g/mol. Its IUPAC name is ditert-butyl-(3,3-dimethyl-1-phenyl-4-trimethylsilyl-4aH-2,3-benzoxasilin-4-yl)-methylsilane.
| Compound Name | ditert-butyl-(3,3-dimethyl-1-phenyl-4-trimethylsilyl-4aH-2,3-benzoxasilin-4-yl)-methylsilane |
|---|---|
| PubChem CID | 15784111 |
| Molecular Formula | C28H46OSi3 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | ditert-butyl-(3,3-dimethyl-1-phenyl-4-trimethylsilyl-4aH-2,3-benzoxasilin-4-yl)-methylsilane |
| SMILES | CC(C)(C)[Si](C)(C(C)(C)C)C1([Si](C)(C)C)C2C=CC=CC2=C(c2ccccc2)O[Si]1(C)C |
| InChI | InChI=1S/C28H46OSi3/c1-26(2,3)32(12,27(4,5)6)28(30(7,8)9)24-21-17-16-20-23(24)25(29-31(28,10)11)22-18-14-13-15-19-22/h13-21,24H,1-12H3 |
| InChIKey | UYOLUEQKTBTFMG-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|