C16H16O4 — CID 15784430
1-benzyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane (PubChem CID 15784430) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-benzyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane.
| Compound Name | 1-benzyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane |
|---|---|
| PubChem CID | 15784430 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-benzyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane |
| SMILES | c1ccc(CC23OC4OC5OC(O2)C2C5CC4C23)cc1 |
| InChI | InChI=1S/C16H16O4/c1-2-4-8(5-3-1)7-16-12-10-6-9-11(12)15(20-16)18-13(9)17-14(10)19-16/h1-5,9-15H,6-7H2 |
| InChIKey | MWWQRZLDDHNSHG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |