C16H29NO5 — CID 15785002
[(2S,3R)-1-methoxy-3,4-dimethyl-1-oxopentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 15785002) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is [(2S,3R)-1-methoxy-3,4-dimethyl-1-oxopentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(2S,3R)-1-methoxy-3,4-dimethyl-1-oxopentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15785002 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | [(2S,3R)-1-methoxy-3,4-dimethyl-1-oxopentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H](OC(=O)N1C(C)(C)COC1(C)C)[C@H](C)C(C)C |
| InChI | InChI=1S/C16H29NO5/c1-10(2)11(3)12(13(18)20-8)22-14(19)17-15(4,5)9-21-16(17,6)7/h10-12H,9H2,1-8H3/t11-,12+/m1/s1 |
| InChIKey | ULKNKBDSWWUOHO-NEPJUHHUSA-N |
| XLogP | 2.80 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |