About 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine
3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine (PubChem CID 15785993) has the molecular formula C14H14N4
and a molecular weight of 238.29 g/mol. Its IUPAC name is 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine.
Molecular Properties
| Compound Name | 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine |
| PubChem CID | 15785993 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine |
| SMILES | Cc1nnc(C)c2c(C)n(-c3ccccc3)nc12 |
| InChI | InChI=1S/C14H14N4/c1-9-13-11(3)18(12-7-5-4-6-8-12)17-14(13)10(2)16-15-9/h4-8H,1-3H3 |
| InChIKey | JQNROROAQAJZSM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine?
The IUPAC name of 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine (CID 15785993) is 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine.
What is the SMILES notation for 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine?
The canonical SMILES for 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine is Cc1nnc(C)c2c(C)n(-c3ccccc3)nc12.
What is the InChIKey of 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine?
The InChIKey is JQNROROAQAJZSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4/c1-9-13-11(3)18(12-7-5-4-6-8-12)17-14(13)10(2)16-15-9/h4-8H,1-3H3.
What are the key properties of 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine?
3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine has a molecular weight of 238.29 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,7-trimethyl-2-phenylpyrazolo[3,4-d]pyridazine is sourced from PubChem (CID 15785993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).