C31H50O2 — CID 15786254
methyl 3-[(3S,4S,8S,9R,10S,13R,14R,17R)-4,8,9,13-tetramethyl-17-propan-2-yl-3-prop-1-en-2-yl-2,3,7,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-4-yl]propanoate (PubChem CID 15786254) has the molecular formula C31H50O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is methyl 3-[(3S,4S,8S,9R,10S,13R,14R,17R)-4,8,9,13-tetramethyl-17-propan-2-yl-3-prop-1-en-2-yl-2,3,7,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-4-yl]propanoate.
| Compound Name | methyl 3-[(3S,4S,8S,9R,10S,13R,14R,17R)-4,8,9,13-tetramethyl-17-propan-2-yl-3-prop-1-en-2-yl-2,3,7,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-4-yl]propanoate |
|---|---|
| PubChem CID | 15786254 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | methyl 3-[(3S,4S,8S,9R,10S,13R,14R,17R)-4,8,9,13-tetramethyl-17-propan-2-yl-3-prop-1-en-2-yl-2,3,7,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-4-yl]propanoate |
| SMILES | C=C(C)[C@@H]1CC[C@@H]2C(=CC[C@@]3(C)[C@@H]4CC[C@H](C(C)C)[C@@]4(C)CC[C@]23C)[C@@]1(C)CCC(=O)OC |
| InChI | InChI=1S/C31H50O2/c1-20(2)22-10-11-25-24(28(22,5)16-15-27(32)33-9)14-17-31(8)26-13-12-23(21(3)4)29(26,6)18-19-30(25,31)7/h14,21-23,25-26H,1,10-13,15-19H2,2-9H3/t22-,23+,25+,26+,28-,29+,30+,31-/m0/s1 |
| InChIKey | BDDXSALGPIOQII-RSUIOEQVSA-N |
| XLogP | 8.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|