About 2-ethoxy-3-nitropyridine
2-ethoxy-3-nitropyridine (PubChem CID 15786625) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is 2-ethoxy-3-nitropyridine.
Molecular Properties
| Compound Name | 2-ethoxy-3-nitropyridine |
| PubChem CID | 15786625 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 2-ethoxy-3-nitropyridine |
| SMILES | CCOc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8N2O3/c1-2-12-7-6(9(10)11)4-3-5-8-7/h3-5H,2H2,1H3 |
| InChIKey | KJTXUEVNNJSFJA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-3-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-nitropyridine?
The IUPAC name of 2-ethoxy-3-nitropyridine (CID 15786625) is 2-ethoxy-3-nitropyridine.
What is the SMILES notation for 2-ethoxy-3-nitropyridine?
The canonical SMILES for 2-ethoxy-3-nitropyridine is CCOc1ncccc1[N+](=O)[O-].
What is the InChIKey of 2-ethoxy-3-nitropyridine?
The InChIKey is KJTXUEVNNJSFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c1-2-12-7-6(9(10)11)4-3-5-8-7/h3-5H,2H2,1H3.
What are the key properties of 2-ethoxy-3-nitropyridine?
2-ethoxy-3-nitropyridine has a molecular weight of 168.15 g/mol, XLogP of 1.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-nitropyridine is sourced from PubChem (CID 15786625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).