C7H14O2 — CID 15787000
(3S)-3-[(1S)-1-methoxyethyl]-2,2-dimethyloxirane (PubChem CID 15787000) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is (3S)-3-[(1S)-1-methoxyethyl]-2,2-dimethyloxirane.
| Compound Name | (3S)-3-[(1S)-1-methoxyethyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 15787000 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (3S)-3-[(1S)-1-methoxyethyl]-2,2-dimethyloxirane |
| SMILES | CO[C@@H](C)[C@@H]1OC1(C)C |
| InChI | InChI=1S/C7H14O2/c1-5(8-4)6-7(2,3)9-6/h5-6H,1-4H3/t5-,6-/m0/s1 |
| InChIKey | UQPWWNHMIHHXSE-WDSKDSINSA-N |
| XLogP | 1.20 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|