About CID 15787731
CID 15787731 (PubChem CID 15787731) has the molecular formula Cl2O6S2Zn
and a molecular weight of 296.42 g/mol.
Molecular Properties
| Compound Name | CID 15787731 |
| PubChem CID | 15787731 |
| Molecular Formula | Cl2O6S2Zn |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 293.78 |
| IUPAC Name | — |
| SMILES | O=S(=O)([O-])Cl.O=S(=O)([O-])Cl.[Zn+2] |
| InChI | InChI=1S/2ClHO3S.Zn/c2*1-5(2,3)4;/h2*(H,2,3,4);/q;;+2/p-2 |
| InChIKey | YWUPLNXEYLFVNL-UHFFFAOYSA-L |
| XLogP | -0.63 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 15787731 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15787731?
The IUPAC name of CID 15787731 (CID 15787731) is not available.
What is the SMILES notation for CID 15787731?
The canonical SMILES for CID 15787731 is O=S(=O)([O-])Cl.O=S(=O)([O-])Cl.[Zn+2].
What is the InChIKey of CID 15787731?
The InChIKey is YWUPLNXEYLFVNL-UHFFFAOYSA-L. The full InChI is InChI=1S/2ClHO3S.Zn/c2*1-5(2,3)4;/h2*(H,2,3,4);/q;;+2/p-2.
What are the key properties of CID 15787731?
CID 15787731 has a molecular weight of 296.42 g/mol, XLogP of -0.63, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15787731 is sourced from PubChem (CID 15787731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).