About 2,5-diethoxy-2,5-dihydrofuran
2,5-diethoxy-2,5-dihydrofuran (PubChem CID 15787793) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2,5-diethoxy-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 2,5-diethoxy-2,5-dihydrofuran |
| PubChem CID | 15787793 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2,5-diethoxy-2,5-dihydrofuran |
| SMILES | CCOC1C=CC(OCC)O1 |
| InChI | InChI=1S/C8H14O3/c1-3-9-7-5-6-8(11-7)10-4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | BUIVDANEHFRPEQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-diethoxy-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diethoxy-2,5-dihydrofuran?
The IUPAC name of 2,5-diethoxy-2,5-dihydrofuran (CID 15787793) is 2,5-diethoxy-2,5-dihydrofuran.
What is the SMILES notation for 2,5-diethoxy-2,5-dihydrofuran?
The canonical SMILES for 2,5-diethoxy-2,5-dihydrofuran is CCOC1C=CC(OCC)O1.
What is the InChIKey of 2,5-diethoxy-2,5-dihydrofuran?
The InChIKey is BUIVDANEHFRPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-3-9-7-5-6-8(11-7)10-4-2/h5-8H,3-4H2,1-2H3.
What are the key properties of 2,5-diethoxy-2,5-dihydrofuran?
2,5-diethoxy-2,5-dihydrofuran has a molecular weight of 158.20 g/mol, XLogP of 1.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diethoxy-2,5-dihydrofuran is sourced from PubChem (CID 15787793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).