C8H9F7O — CID 15788982
3-butyl-2,2,3,4,4,5,5-heptafluorooxolane (PubChem CID 15788982) has the molecular formula C8H9F7O and a molecular weight of 254.14 g/mol. Its IUPAC name is 3-butyl-2,2,3,4,4,5,5-heptafluorooxolane.
| Compound Name | 3-butyl-2,2,3,4,4,5,5-heptafluorooxolane |
|---|---|
| PubChem CID | 15788982 |
| Molecular Formula | C8H9F7O |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-butyl-2,2,3,4,4,5,5-heptafluorooxolane |
| SMILES | CCCCC1(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C8H9F7O/c1-2-3-4-5(9)6(10,11)8(14,15)16-7(5,12)13/h2-4H2,1H3 |
| InChIKey | LOOBZEVHBGGWLM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|