C39H34F6N4O4 — CID 15789182
2-(4-amino-2,3,5,6-tetramethylphenyl)-5-[2-[2-(4-amino-2,3,5,6-tetramethylphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione (PubChem CID 15789182) has the molecular formula C39H34F6N4O4 and a molecular weight of 736.71 g/mol. Its IUPAC name is 2-(4-amino-2,3,5,6-tetramethylphenyl)-5-[2-[2-(4-amino-2,3,5,6-tetramethylphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-(4-amino-2,3,5,6-tetramethylphenyl)-5-[2-[2-(4-amino-2,3,5,6-tetramethylphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15789182 |
| Molecular Formula | C39H34F6N4O4 |
| Molecular Weight | 736.71 g/mol |
| Exact Mass | 736.25 |
| IUPAC Name | 2-(4-amino-2,3,5,6-tetramethylphenyl)-5-[2-[2-(4-amino-2,3,5,6-tetramethylphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione |
| SMILES | Cc1c(C)c(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(c4c(C)c(C)c(N)c(C)c4C)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)c(C)c(C)c1N |
| InChI | InChI=1S/C39H34F6N4O4/c1-15-19(5)31(20(6)16(2)29(15)46)48-33(50)25-11-9-23(13-27(25)35(48)52)37(38(40,41)42,39(43,44)45)24-10-12-26-28(14-24)36(53)49(34(26)51)32-21(7)17(3)30(47)18(4)22(32)8/h9-14H,46-47H2,1-8H3 |
| InChIKey | AEMBIPCZXSBWML-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.71 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|