About 2,2-difluoroethoxybenzene
2,2-difluoroethoxybenzene (PubChem CID 15789467) has the molecular formula C8H8F2O
and a molecular weight of 158.15 g/mol. Its IUPAC name is 2,2-difluoroethoxybenzene.
Molecular Properties
| Compound Name | 2,2-difluoroethoxybenzene |
| PubChem CID | 15789467 |
| Molecular Formula | C8H8F2O |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 2,2-difluoroethoxybenzene |
| SMILES | FC(F)COc1ccccc1 |
| InChI | InChI=1S/C8H8F2O/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | HOKWHGYUNYFNTP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluoroethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethoxybenzene?
The IUPAC name of 2,2-difluoroethoxybenzene (CID 15789467) is 2,2-difluoroethoxybenzene.
What is the SMILES notation for 2,2-difluoroethoxybenzene?
The canonical SMILES for 2,2-difluoroethoxybenzene is FC(F)COc1ccccc1.
What is the InChIKey of 2,2-difluoroethoxybenzene?
The InChIKey is HOKWHGYUNYFNTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2O/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5,8H,6H2.
What are the key properties of 2,2-difluoroethoxybenzene?
2,2-difluoroethoxybenzene has a molecular weight of 158.15 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethoxybenzene is sourced from PubChem (CID 15789467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).