C14H19N — CID 15789536
(3S)-1,3-dimethyl-2-methylidene-3-propylindole (PubChem CID 15789536) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (3S)-1,3-dimethyl-2-methylidene-3-propylindole.
| Compound Name | (3S)-1,3-dimethyl-2-methylidene-3-propylindole |
|---|---|
| PubChem CID | 15789536 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (3S)-1,3-dimethyl-2-methylidene-3-propylindole |
| SMILES | C=C1N(C)c2ccccc2[C@]1(C)CCC |
| InChI | InChI=1S/C14H19N/c1-5-10-14(3)11(2)15(4)13-9-7-6-8-12(13)14/h6-9H,2,5,10H2,1,3-4H3/t14-/m1/s1 |
| InChIKey | GKZUGVPFUXMPBO-CQSZACIVSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |