C14H15FN2O2 — CID 15790235
(3S,8aS)-3-[(4-fluorophenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 15790235) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is (3S,8aS)-3-[(4-fluorophenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,8aS)-3-[(4-fluorophenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 15790235 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (3S,8aS)-3-[(4-fluorophenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1N[C@@H](Cc2ccc(F)cc2)C(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C14H15FN2O2/c15-10-5-3-9(4-6-10)8-11-14(19)17-7-1-2-12(17)13(18)16-11/h3-6,11-12H,1-2,7-8H2,(H,16,18)/t11-,12-/m0/s1 |
| InChIKey | QEUBZZYHXSGWAV-RYUDHWBXSA-N |
| XLogP | 0.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |