About 8-fluoroquinolin-4-amine
8-fluoroquinolin-4-amine (PubChem CID 15790504) has the molecular formula C9H7FN2
and a molecular weight of 162.17 g/mol. Its IUPAC name is 8-fluoroquinolin-4-amine.
Molecular Properties
| Compound Name | 8-fluoroquinolin-4-amine |
| PubChem CID | 15790504 |
| Molecular Formula | C9H7FN2 |
| Molecular Weight | 162.17 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 8-fluoroquinolin-4-amine |
| SMILES | Nc1ccnc2c(F)cccc12 |
| InChI | InChI=1S/C9H7FN2/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-5H,(H2,11,12) |
| InChIKey | PFULPFXDXVNQCQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoroquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoroquinolin-4-amine?
The IUPAC name of 8-fluoroquinolin-4-amine (CID 15790504) is 8-fluoroquinolin-4-amine.
What is the SMILES notation for 8-fluoroquinolin-4-amine?
The canonical SMILES for 8-fluoroquinolin-4-amine is Nc1ccnc2c(F)cccc12.
What is the InChIKey of 8-fluoroquinolin-4-amine?
The InChIKey is PFULPFXDXVNQCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN2/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-5H,(H2,11,12).
What are the key properties of 8-fluoroquinolin-4-amine?
8-fluoroquinolin-4-amine has a molecular weight of 162.17 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoroquinolin-4-amine is sourced from PubChem (CID 15790504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).