C22H34N2O — CID 15790718
4-[4-(2,4,4-trimethylpentan-2-yl)cyclohex-3-en-1-yl]oxy-5,6,7,8-tetrahydroquinazoline (PubChem CID 15790718) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is 4-[4-(2,4,4-trimethylpentan-2-yl)cyclohex-3-en-1-yl]oxy-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-[4-(2,4,4-trimethylpentan-2-yl)cyclohex-3-en-1-yl]oxy-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 15790718 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 4-[4-(2,4,4-trimethylpentan-2-yl)cyclohex-3-en-1-yl]oxy-5,6,7,8-tetrahydroquinazoline |
| SMILES | CC(C)(C)CC(C)(C)C1=CCC(Oc2ncnc3c2CCCC3)CC1 |
| InChI | InChI=1S/C22H34N2O/c1-21(2,3)14-22(4,5)16-10-12-17(13-11-16)25-20-18-8-6-7-9-19(18)23-15-24-20/h10,15,17H,6-9,11-14H2,1-5H3 |
| InChIKey | MAPLWGCWQBCXME-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|