About Dihexylfluorosilane
Dihexylfluorosilane (PubChem CID 15791873) has the molecular formula C12H26FSi
and a molecular weight of 217.42 g/mol.
Molecular Properties
| Compound Name | Dihexylfluorosilane |
| PubChem CID | 15791873 |
| Molecular Formula | C12H26FSi |
| Molecular Weight | 217.42 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | — |
| SMILES | CCCCCC[Si](F)CCCCCC |
| InChI | InChI=1S/C12H26FSi/c1-3-5-7-9-11-14(13)12-10-8-6-4-2/h3-12H2,1-2H3 |
| InChIKey | VMKBANVNYXNWIH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 217.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze Dihexylfluorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dihexylfluorosilane?
The IUPAC name of Dihexylfluorosilane (CID 15791873) is not available.
What is the SMILES notation for Dihexylfluorosilane?
The canonical SMILES for Dihexylfluorosilane is CCCCCC[Si](F)CCCCCC.
What is the InChIKey of Dihexylfluorosilane?
The InChIKey is VMKBANVNYXNWIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26FSi/c1-3-5-7-9-11-14(13)12-10-8-6-4-2/h3-12H2,1-2H3.
What are the key properties of Dihexylfluorosilane?
Dihexylfluorosilane has a molecular weight of 217.42 g/mol, XLogP of 5.11, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Dihexylfluorosilane is sourced from PubChem (CID 15791873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).