C41H38N10O — CID 15794189
2,6-bis[[bis(1H-benzimidazol-2-ylmethyl)amino]methyl]-4-methylphenol (PubChem CID 15794189) has the molecular formula C41H38N10O and a molecular weight of 686.82 g/mol. Its IUPAC name is 2,6-bis[[bis(1H-benzimidazol-2-ylmethyl)amino]methyl]-4-methylphenol.
| Compound Name | 2,6-bis[[bis(1H-benzimidazol-2-ylmethyl)amino]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 15794189 |
| Molecular Formula | C41H38N10O |
| Molecular Weight | 686.82 g/mol |
| Exact Mass | 686.32 |
| IUPAC Name | 2,6-bis[[bis(1H-benzimidazol-2-ylmethyl)amino]methyl]-4-methylphenol |
| SMILES | Cc1cc(CN(Cc2nc3ccccc3[nH]2)Cc2nc3ccccc3[nH]2)c(O)c(CN(Cc2nc3ccccc3[nH]2)Cc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C41H38N10O/c1-26-18-27(20-50(22-37-42-29-10-2-3-11-30(29)43-37)23-38-44-31-12-4-5-13-32(31)45-38)41(52)28(19-26)21-51(24-39-46-33-14-6-7-15-34(33)47-39)25-40-48-35-16-8-9-17-36(35)49-40/h2-19,52H,20-25H2,1H3,(H,42,43)(H,44,45)(H,46,47)(H,48,49) |
| InChIKey | UHPOPCGQRZHLAI-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 141.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.82 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|