About N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine
N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine (PubChem CID 15795401) has the molecular formula C8H21N5O2
and a molecular weight of 219.29 g/mol. Its IUPAC name is N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine.
Molecular Properties
| Compound Name | N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine |
| PubChem CID | 15795401 |
| Molecular Formula | C8H21N5O2 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine |
| SMILES | CC(CNCCN)(CNCCN)[N+](=O)[O-] |
| InChI | InChI=1S/C8H21N5O2/c1-8(13(14)15,6-11-4-2-9)7-12-5-3-10/h11-12H,2-7,9-10H2,1H3 |
| InChIKey | YGCJERAHNLQXOI-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine?
The IUPAC name of N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine (CID 15795401) is N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine.
What is the SMILES notation for N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine?
The canonical SMILES for N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine is CC(CNCCN)(CNCCN)[N+](=O)[O-].
What is the InChIKey of N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine?
The InChIKey is YGCJERAHNLQXOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21N5O2/c1-8(13(14)15,6-11-4-2-9)7-12-5-3-10/h11-12H,2-7,9-10H2,1H3.
What are the key properties of N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine?
N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine has a molecular weight of 219.29 g/mol, XLogP of -1.88, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(2-aminoethyl)-2-methyl-2-nitropropane-1,3-diamine is sourced from PubChem (CID 15795401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).