About hexa-1,5-diene-3-thiol
hexa-1,5-diene-3-thiol (PubChem CID 15796217) has the molecular formula C6H10S
and a molecular weight of 114.21 g/mol. Its IUPAC name is hexa-1,5-diene-3-thiol.
Molecular Properties
| Compound Name | hexa-1,5-diene-3-thiol |
| PubChem CID | 15796217 |
| Molecular Formula | C6H10S |
| Molecular Weight | 114.21 g/mol |
| Exact Mass | 114.05 |
| IUPAC Name | hexa-1,5-diene-3-thiol |
| SMILES | C=CCC(S)C=C |
| InChI | InChI=1S/C6H10S/c1-3-5-6(7)4-2/h3-4,6-7H,1-2,5H2 |
| InChIKey | OVGZALMHKNFPJF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze hexa-1,5-diene-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-1,5-diene-3-thiol?
The IUPAC name of hexa-1,5-diene-3-thiol (CID 15796217) is hexa-1,5-diene-3-thiol.
What is the SMILES notation for hexa-1,5-diene-3-thiol?
The canonical SMILES for hexa-1,5-diene-3-thiol is C=CCC(S)C=C.
What is the InChIKey of hexa-1,5-diene-3-thiol?
The InChIKey is OVGZALMHKNFPJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10S/c1-3-5-6(7)4-2/h3-4,6-7H,1-2,5H2.
What are the key properties of hexa-1,5-diene-3-thiol?
hexa-1,5-diene-3-thiol has a molecular weight of 114.21 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-1,5-diene-3-thiol is sourced from PubChem (CID 15796217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).