About 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene
6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene (PubChem CID 15797704) has the molecular formula C13H11Cl3
and a molecular weight of 273.59 g/mol. Its IUPAC name is 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene |
| PubChem CID | 15797704 |
| Molecular Formula | C13H11Cl3 |
| Molecular Weight | 273.59 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene |
| SMILES | CC1(C(Cl)(Cl)Cl)C=CC(=C2C=CC=C2)C=C1 |
| InChI | InChI=1S/C13H11Cl3/c1-12(13(14,15)16)8-6-11(7-9-12)10-4-2-3-5-10/h2-9H,1H3 |
| InChIKey | DSUPAGVEVHPBAI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene?
The IUPAC name of 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene (CID 15797704) is 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene.
What is the SMILES notation for 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene?
The canonical SMILES for 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene is CC1(C(Cl)(Cl)Cl)C=CC(=C2C=CC=C2)C=C1.
What is the InChIKey of 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene?
The InChIKey is DSUPAGVEVHPBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl3/c1-12(13(14,15)16)8-6-11(7-9-12)10-4-2-3-5-10/h2-9H,1H3.
What are the key properties of 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene?
6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene has a molecular weight of 273.59 g/mol, XLogP of 4.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopenta-2,4-dien-1-ylidene-3-methyl-3-(trichloromethyl)cyclohexa-1,4-diene is sourced from PubChem (CID 15797704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).