About CID 15798742
CID 15798742 (PubChem CID 15798742) has the molecular formula C30H48PSi
and a molecular weight of 467.77 g/mol.
Molecular Properties
| Compound Name | CID 15798742 |
| PubChem CID | 15798742 |
| Molecular Formula | C30H48PSi |
| Molecular Weight | 467.77 g/mol |
| Exact Mass | 467.33 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(C(C)C)cc(C(C)(C)[Si](P)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c1 |
| InChI | InChI=1S/C30H48PSi/c1-18(2)23-13-24(19(3)4)15-26(14-23)30(11,12)32(31)29-27(21(7)8)16-25(20(5)6)17-28(29)22(9)10/h13-22H,31H2,1-12H3 |
| InChIKey | UCJQHRKZFDTUAO-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.77 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 15798742 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15798742?
The IUPAC name of CID 15798742 (CID 15798742) is not available.
What is the SMILES notation for CID 15798742?
The canonical SMILES for CID 15798742 is CC(C)c1cc(C(C)C)cc(C(C)(C)[Si](P)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c1.
What is the InChIKey of CID 15798742?
The InChIKey is UCJQHRKZFDTUAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H48PSi/c1-18(2)23-13-24(19(3)4)15-26(14-23)30(11,12)32(31)29-27(21(7)8)16-25(20(5)6)17-28(29)22(9)10/h13-22H,31H2,1-12H3.
What are the key properties of CID 15798742?
CID 15798742 has a molecular weight of 467.77 g/mol, XLogP of 8.89, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15798742 is sourced from PubChem (CID 15798742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).