C7H14O4 — CID 158000416
(2R,3S,4S)-2-ethyl-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 158000416) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is (2R,3S,4S)-2-ethyl-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S)-2-ethyl-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 158000416 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (2R,3S,4S)-2-ethyl-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC[C@]1(CO)OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O4/c1-2-7(4-8)6(10)5(9)3-11-7/h5-6,8-10H,2-4H2,1H3/t5-,6-,7+/m0/s1 |
| InChIKey | RFHBLPOTJXUHJZ-LYFYHCNISA-N |
| XLogP | -1.12 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |