About decan-1-ol;decyl prop-2-enoate
decan-1-ol;decyl prop-2-enoate (PubChem CID 158001479) has the molecular formula C23H46O3
and a molecular weight of 370.62 g/mol. Its IUPAC name is decan-1-ol;decyl prop-2-enoate.
Molecular Properties
| Compound Name | decan-1-ol;decyl prop-2-enoate |
| PubChem CID | 158001479 |
| Molecular Formula | C23H46O3 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.34 |
| IUPAC Name | decan-1-ol;decyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCCC.CCCCCCCCCCO |
| InChI | InChI=1S/C13H24O2.C10H22O/c1-3-5-6-7-8-9-10-11-12-15-13(14)4-2;1-2-3-4-5-6-7-8-9-10-11/h4H,2-3,5-12H2,1H3;11H,2-10H2,1H3 |
| InChIKey | FDUCXYUXZPBIBL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze decan-1-ol;decyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-1-ol;decyl prop-2-enoate?
The IUPAC name of decan-1-ol;decyl prop-2-enoate (CID 158001479) is decan-1-ol;decyl prop-2-enoate.
What is the SMILES notation for decan-1-ol;decyl prop-2-enoate?
The canonical SMILES for decan-1-ol;decyl prop-2-enoate is C=CC(=O)OCCCCCCCCCC.CCCCCCCCCCO.
What is the InChIKey of decan-1-ol;decyl prop-2-enoate?
The InChIKey is FDUCXYUXZPBIBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2.C10H22O/c1-3-5-6-7-8-9-10-11-12-15-13(14)4-2;1-2-3-4-5-6-7-8-9-10-11/h4H,2-3,5-12H2,1H3;11H,2-10H2,1H3.
What are the key properties of decan-1-ol;decyl prop-2-enoate?
decan-1-ol;decyl prop-2-enoate has a molecular weight of 370.62 g/mol, XLogP of 6.98, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decan-1-ol;decyl prop-2-enoate is sourced from PubChem (CID 158001479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).