C23H30ClF3N4O7S2 — CID 158001981
(4R)-2-[2-[[[(3S)-3-[(2S)-2-amino-3-methylbutanoyl]oxy-7-chlorohept-4-enoyl]amino]methyl]-1,3-thiazol-4-yl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 158001981) has the molecular formula C23H30ClF3N4O7S2 and a molecular weight of 631.10 g/mol. Its IUPAC name is (4R)-2-[2-[[[(3S)-3-[(2S)-2-amino-3-methylbutanoyl]oxy-7-chlorohept-4-enoyl]amino]methyl]-1,3-thiazol-4-yl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (4R)-2-[2-[[[(3S)-3-[(2S)-2-amino-3-methylbutanoyl]oxy-7-chlorohept-4-enoyl]amino]methyl]-1,3-thiazol-4-yl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158001981 |
| Molecular Formula | C23H30ClF3N4O7S2 |
| Molecular Weight | 631.10 g/mol |
| Exact Mass | 630.12 |
| IUPAC Name | (4R)-2-[2-[[[(3S)-3-[(2S)-2-amino-3-methylbutanoyl]oxy-7-chlorohept-4-enoyl]amino]methyl]-1,3-thiazol-4-yl]-4-methyl-5H-1,3-thiazole-4-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)[C@H](N)C(=O)O[C@H](C=CCCCl)CC(=O)NCc1nc(C2=N[C@](C)(C(=O)O)CS2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H29ClN4O5S2.C2HF3O2/c1-12(2)17(23)19(28)31-13(6-4-5-7-22)8-15(27)24-9-16-25-14(10-32-16)18-26-21(3,11-33-18)20(29)30;3-2(4,5)1(6)7/h4,6,10,12-13,17H,5,7-9,11,23H2,1-3H3,(H,24,27)(H,29,30);(H,6,7)/t13-,17+,21+;/m1./s1 |
| InChIKey | FDVNUDOYWXJUBB-YSBQDGKGSA-N |
| XLogP | 3.20 |
| TPSA | 181.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.10 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|