C40H36ClN9 — CID 158002843
6-chloro-3-(1,5-dimethylindol-2-yl)imidazo[1,2-b]pyridazine;3-(1,5-dimethylindol-2-yl)-N-(3,4-dimethylphenyl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 158002843) has the molecular formula C40H36ClN9 and a molecular weight of 678.24 g/mol. Its IUPAC name is 6-chloro-3-(1,5-dimethylindol-2-yl)imidazo[1,2-b]pyridazine;3-(1,5-dimethylindol-2-yl)-N-(3,4-dimethylphenyl)imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 6-chloro-3-(1,5-dimethylindol-2-yl)imidazo[1,2-b]pyridazine;3-(1,5-dimethylindol-2-yl)-N-(3,4-dimethylphenyl)imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 158002843 |
| Molecular Formula | C40H36ClN9 |
| Molecular Weight | 678.24 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | 6-chloro-3-(1,5-dimethylindol-2-yl)imidazo[1,2-b]pyridazine;3-(1,5-dimethylindol-2-yl)-N-(3,4-dimethylphenyl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | Cc1ccc2c(c1)cc(-c1cnc3ccc(Cl)nn13)n2C.Cc1ccc2c(c1)cc(-c1cnc3ccc(Nc4ccc(C)c(C)c4)nn13)n2C |
| InChI | InChI=1S/C24H23N5.C16H13ClN4/c1-15-5-8-20-18(11-15)13-21(28(20)4)22-14-25-24-10-9-23(27-29(22)24)26-19-7-6-16(2)17(3)12-19;1-10-3-4-12-11(7-10)8-13(20(12)2)14-9-18-16-6-5-15(17)19-21(14)16/h5-14H,1-4H3,(H,26,27);3-9H,1-2H3 |
| InChIKey | FDYAFGLGRSRBSY-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.24 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |