C26H22F4N2O2 — CID 158003854
(3S)-1-[4-(2-fluoro-3-pyridinyl)phenyl]-3-[2-oxo-3-[4-(trifluoromethyl)phenyl]propyl]piperidin-2-one (PubChem CID 158003854) has the molecular formula C26H22F4N2O2 and a molecular weight of 470.47 g/mol. Its IUPAC name is (3S)-1-[4-(2-fluoro-3-pyridinyl)phenyl]-3-[2-oxo-3-[4-(trifluoromethyl)phenyl]propyl]piperidin-2-one.
| Compound Name | (3S)-1-[4-(2-fluoro-3-pyridinyl)phenyl]-3-[2-oxo-3-[4-(trifluoromethyl)phenyl]propyl]piperidin-2-one |
|---|---|
| PubChem CID | 158003854 |
| Molecular Formula | C26H22F4N2O2 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | (3S)-1-[4-(2-fluoro-3-pyridinyl)phenyl]-3-[2-oxo-3-[4-(trifluoromethyl)phenyl]propyl]piperidin-2-one |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)C[C@@H]1CCCN(c2ccc(-c3cccnc3F)cc2)C1=O |
| InChI | InChI=1S/C26H22F4N2O2/c27-24-23(4-1-13-31-24)18-7-11-21(12-8-18)32-14-2-3-19(25(32)34)16-22(33)15-17-5-9-20(10-6-17)26(28,29)30/h1,4-13,19H,2-3,14-16H2/t19-/m0/s1 |
| InChIKey | FEAYKWUIJZNFGJ-IBGZPJMESA-N |
| XLogP | 5.85 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|