C53H26Cl6N6 — CID 158006006
2,5-di(carbazol-9-yl)-3,6-dichlorobenzene-1,4-dicarbonitrile;9H-fluorene;2,3,5,6-tetrachlorobenzene-1,4-dicarbonitrile (PubChem CID 158006006) has the molecular formula C53H26Cl6N6 and a molecular weight of 959.55 g/mol. Its IUPAC name is 2,5-di(carbazol-9-yl)-3,6-dichlorobenzene-1,4-dicarbonitrile;9H-fluorene;2,3,5,6-tetrachlorobenzene-1,4-dicarbonitrile.
| Compound Name | 2,5-di(carbazol-9-yl)-3,6-dichlorobenzene-1,4-dicarbonitrile;9H-fluorene;2,3,5,6-tetrachlorobenzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 158006006 |
| Molecular Formula | C53H26Cl6N6 |
| Molecular Weight | 959.55 g/mol |
| Exact Mass | 956.04 |
| IUPAC Name | 2,5-di(carbazol-9-yl)-3,6-dichlorobenzene-1,4-dicarbonitrile;9H-fluorene;2,3,5,6-tetrachlorobenzene-1,4-dicarbonitrile |
| SMILES | N#Cc1c(Cl)c(-n2c3ccccc3c3ccccc32)c(C#N)c(Cl)c1-n1c2ccccc2c2ccccc21.N#Cc1c(Cl)c(Cl)c(C#N)c(Cl)c1Cl.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C32H16Cl2N4.C13H10.C8Cl4N2/c33-29-24(18-36)32(38-27-15-7-3-11-21(27)22-12-4-8-16-28(22)38)30(34)23(17-35)31(29)37-25-13-5-1-9-19(25)20-10-2-6-14-26(20)37;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;9-5-3(1-13)6(10)8(12)4(2-14)7(5)11/h1-16H;1-8H,9H2; |
| InChIKey | FEHLRCJAOUBDSN-UHFFFAOYSA-N |
| XLogP | 16.23 |
| TPSA | 105.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.55 |
| LogP ≤ 5 | 16.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|