About dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate
dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate (PubChem CID 158006083) has the molecular formula C7H10Cl4N2O5Pt
and a molecular weight of 539.06 g/mol. Its IUPAC name is dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate.
Molecular Properties
| Compound Name | dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate |
| PubChem CID | 158006083 |
| Molecular Formula | C7H10Cl4N2O5Pt |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 536.90 |
| IUPAC Name | dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate |
| SMILES | CCOC(=O)N(Cl)C(=O)N(Cl)C(=O)OCC.Cl[Pt]Cl |
| InChI | InChI=1S/C7H10Cl2N2O5.2ClH.Pt/c1-3-15-6(13)10(8)5(12)11(9)7(14)16-4-2;;;/h3-4H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | FEHSORIRJLVJKV-UHFFFAOYSA-L |
| XLogP | 3.71 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate?
The IUPAC name of dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate (CID 158006083) is dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate.
What is the SMILES notation for dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate?
The canonical SMILES for dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate is CCOC(=O)N(Cl)C(=O)N(Cl)C(=O)OCC.Cl[Pt]Cl.
What is the InChIKey of dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate?
The InChIKey is FEHSORIRJLVJKV-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H10Cl2N2O5.2ClH.Pt/c1-3-15-6(13)10(8)5(12)11(9)7(14)16-4-2;;;/h3-4H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate?
dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate has a molecular weight of 539.06 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;ethyl N-chloro-N-[chloro(ethoxycarbonyl)carbamoyl]carbamate is sourced from PubChem (CID 158006083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).