C43H56N6O5 — CID 158006857
2-N,2-N,4-N,4-N,6-N-pentaethyl-1,3,5-triazine-2,4,6-triamine;phenol (PubChem CID 158006857) has the molecular formula C43H56N6O5 and a molecular weight of 736.96 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N-pentaethyl-1,3,5-triazine-2,4,6-triamine;phenol.
| Compound Name | 2-N,2-N,4-N,4-N,6-N-pentaethyl-1,3,5-triazine-2,4,6-triamine;phenol |
|---|---|
| PubChem CID | 158006857 |
| Molecular Formula | C43H56N6O5 |
| Molecular Weight | 736.96 g/mol |
| Exact Mass | 736.43 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N-pentaethyl-1,3,5-triazine-2,4,6-triamine;phenol |
| SMILES | CCNc1nc(N(CC)CC)nc(N(CC)CC)n1.Oc1ccccc1.Oc1ccccc1.Oc1ccccc1.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C13H26N6.5C6H6O/c1-6-14-11-15-12(18(7-2)8-3)17-13(16-11)19(9-4)10-5;5*7-6-4-2-1-3-5-6/h6-10H2,1-5H3,(H,14,15,16,17);5*1-5,7H |
| InChIKey | FEJYEZKXTBEFBE-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 158.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.96 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |