C41H28N6O5S2 — CID 158007408
N'-hydroxy-4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide;3-[4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-yl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 158007408) has the molecular formula C41H28N6O5S2 and a molecular weight of 748.85 g/mol. Its IUPAC name is N'-hydroxy-4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide;3-[4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-yl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | N'-hydroxy-4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide;3-[4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-yl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 158007408 |
| Molecular Formula | C41H28N6O5S2 |
| Molecular Weight | 748.85 g/mol |
| Exact Mass | 748.16 |
| IUPAC Name | N'-hydroxy-4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide;3-[4-(4-phenylphenoxy)thieno[2,3-c]pyridin-2-yl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | NC(=NO)c1cc2c(Oc3ccc(-c4ccccc4)cc3)cncc2s1.O=c1[nH]c(-c2cc3c(Oc4ccc(-c5ccccc5)cc4)cncc3s2)no1 |
| InChI | InChI=1S/C21H13N3O3S.C20H15N3O2S/c25-21-23-20(24-27-21)18-10-16-17(11-22-12-19(16)28-18)26-15-8-6-14(7-9-15)13-4-2-1-3-5-13;21-20(23-24)18-10-16-17(11-22-12-19(16)26-18)25-15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H,(H,23,24,25);1-12,24H,(H2,21,23) |
| InChIKey | FELRBCPXVVNPDS-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 161.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.85 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|