About 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine
1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 158007639) has the molecular formula C16H13F3N4O
and a molecular weight of 334.30 g/mol. Its IUPAC name is 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
Molecular Properties
| Compound Name | 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| PubChem CID | 158007639 |
| Molecular Formula | C16H13F3N4O |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CC(=O)c1ccccn1.FC(F)(F)c1cc(-c2ccccn2)n[nH]1 |
| InChI | InChI=1S/C9H6F3N3.C7H7NO/c10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;1-6(9)7-4-2-3-5-8-7/h1-5H,(H,14,15);2-5H,1H3 |
| InChIKey | FEMIKMWYZZGYQE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The IUPAC name of 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (CID 158007639) is 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
What is the SMILES notation for 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The canonical SMILES for 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is CC(=O)c1ccccn1.FC(F)(F)c1cc(-c2ccccn2)n[nH]1.
What is the InChIKey of 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The InChIKey is FEMIKMWYZZGYQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3N3.C7H7NO/c10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;1-6(9)7-4-2-3-5-8-7/h1-5H,(H,14,15);2-5H,1H3.
What are the key properties of 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine has a molecular weight of 334.30 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-2-ylethanone;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is sourced from PubChem (CID 158007639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).