C31H33N2O+ — CID 158008138
2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-7-methyl-8-[1-methyl-4-[3-(2-methylpropyl)phenyl]pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 158008138) has the molecular formula C31H33N2O+ and a molecular weight of 456.66 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-7-methyl-8-[1-methyl-4-[3-(2-methylpropyl)phenyl]pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-7-methyl-8-[1-methyl-4-[3-(2-methylpropyl)phenyl]pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 158008138 |
| Molecular Formula | C31H33N2O+ |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | 2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-7-methyl-8-[1-methyl-4-[3-(2-methylpropyl)phenyl]pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])C([2H])(c1ccc2c(n1)oc1c(-c3cc(-c4cccc(CC(C)C)c4)cc[n+]3C)c(C)ccc12)C([2H])([2H])[2H] |
| InChI | InChI=1S/C31H33N2O/c1-19(2)16-22-8-7-9-23(17-22)24-14-15-33(6)28(18-24)29-21(5)10-11-25-26-12-13-27(20(3)4)32-31(26)34-30(25)29/h7-15,17-20H,16H2,1-6H3/q+1/i3D3,4D3,20D |
| InChIKey | DBJUDGRVNKUODJ-ZJSSFZLSSA-N |
| XLogP | 7.77 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|