C18H16N3+ — CID 158008219
6-isocyano-2,3,4-trimethyl-12H-indazolo[1,2-a]indazol-11-ium (PubChem CID 158008219) has the molecular formula C18H16N3+ and a molecular weight of 274.35 g/mol. Its IUPAC name is 6-isocyano-2,3,4-trimethyl-12H-indazolo[1,2-a]indazol-11-ium.
| Compound Name | 6-isocyano-2,3,4-trimethyl-12H-indazolo[1,2-a]indazol-11-ium |
|---|---|
| PubChem CID | 158008219 |
| Molecular Formula | C18H16N3+ |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 6-isocyano-2,3,4-trimethyl-12H-indazolo[1,2-a]indazol-11-ium |
| SMILES | [C-]#[N+]c1cccc2c[n+]3n(c12)-c1c(cc(C)c(C)c1C)C3 |
| InChI | InChI=1S/C18H16N3/c1-11-8-15-10-20-9-14-6-5-7-16(19-4)18(14)21(20)17(15)13(3)12(11)2/h5-9H,10H2,1-3H3/q+1 |
| InChIKey | PMLPPXCFTGAULL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 13.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|