C22H24FN5O3S — CID 158008852
8-(1-ethylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)-5-[2-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 158008852) has the molecular formula C22H24FN5O3S and a molecular weight of 457.53 g/mol. Its IUPAC name is 8-(1-ethylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)-5-[2-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidine.
| Compound Name | 8-(1-ethylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)-5-[2-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 158008852 |
| Molecular Formula | C22H24FN5O3S |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 8-(1-ethylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)-5-[2-(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | CCS(=O)(=O)N1CC=C(c2cnc(CCc3c(F)ccc4c3CCO4)n3cnnc23)CC1 |
| InChI | InChI=1S/C22H24FN5O3S/c1-2-32(29,30)27-10-7-15(8-11-27)18-13-24-21(28-14-25-26-22(18)28)6-3-16-17-9-12-31-20(17)5-4-19(16)23/h4-5,7,13-14H,2-3,6,8-12H2,1H3 |
| InChIKey | ZGPQDMRKQQVMIP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |