About 2,2,4-trimethylpent-4-enyl 3-methylbutanoate
2,2,4-trimethylpent-4-enyl 3-methylbutanoate (PubChem CID 15800967) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 2,2,4-trimethylpent-4-enyl 3-methylbutanoate.
Molecular Properties
| Compound Name | 2,2,4-trimethylpent-4-enyl 3-methylbutanoate |
| PubChem CID | 15800967 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2,2,4-trimethylpent-4-enyl 3-methylbutanoate |
| SMILES | C=C(C)CC(C)(C)COC(=O)CC(C)C |
| InChI | InChI=1S/C13H24O2/c1-10(2)7-12(14)15-9-13(5,6)8-11(3)4/h10H,3,7-9H2,1-2,4-6H3 |
| InChIKey | PYOMDZOLQXHHAZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2,4-trimethylpent-4-enyl 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,4-trimethylpent-4-enyl 3-methylbutanoate?
The IUPAC name of 2,2,4-trimethylpent-4-enyl 3-methylbutanoate (CID 15800967) is 2,2,4-trimethylpent-4-enyl 3-methylbutanoate.
What is the SMILES notation for 2,2,4-trimethylpent-4-enyl 3-methylbutanoate?
The canonical SMILES for 2,2,4-trimethylpent-4-enyl 3-methylbutanoate is C=C(C)CC(C)(C)COC(=O)CC(C)C.
What is the InChIKey of 2,2,4-trimethylpent-4-enyl 3-methylbutanoate?
The InChIKey is PYOMDZOLQXHHAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-10(2)7-12(14)15-9-13(5,6)8-11(3)4/h10H,3,7-9H2,1-2,4-6H3.
What are the key properties of 2,2,4-trimethylpent-4-enyl 3-methylbutanoate?
2,2,4-trimethylpent-4-enyl 3-methylbutanoate has a molecular weight of 212.33 g/mol, XLogP of 3.57, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,4-trimethylpent-4-enyl 3-methylbutanoate is sourced from PubChem (CID 15800967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).