C26H32FN5O — CID 158010141
5-[[4-(4-fluoropiperidin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide (PubChem CID 158010141) has the molecular formula C26H32FN5O and a molecular weight of 449.57 g/mol. Its IUPAC name is 5-[[4-(4-fluoropiperidin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[[4-(4-fluoropiperidin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 158010141 |
| Molecular Formula | C26H32FN5O |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 5-[[4-(4-fluoropiperidin-1-yl)phenyl]methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cc(CNc2n[nH]c(Cc3ccc(N4CCC(F)CC4)cc3)c2C(N)=O)cc(C)c1C |
| InChI | InChI=1S/C26H32FN5O/c1-16-12-20(13-17(2)18(16)3)15-29-26-24(25(28)33)23(30-31-26)14-19-4-6-22(7-5-19)32-10-8-21(27)9-11-32/h4-7,12-13,21H,8-11,14-15H2,1-3H3,(H2,28,33)(H2,29,30,31) |
| InChIKey | XMPPKLBQWMNQSP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|