C23H26O — CID 158010742
2-(2,4-dimethylphenyl)-2,4-bis(ethenyl)-4,7-dimethyl-3H-chromene (PubChem CID 158010742) has the molecular formula C23H26O and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-2,4-bis(ethenyl)-4,7-dimethyl-3H-chromene.
| Compound Name | 2-(2,4-dimethylphenyl)-2,4-bis(ethenyl)-4,7-dimethyl-3H-chromene |
|---|---|
| PubChem CID | 158010742 |
| Molecular Formula | C23H26O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-2,4-bis(ethenyl)-4,7-dimethyl-3H-chromene |
| SMILES | C=CC1(C)CC(C=C)(c2ccc(C)cc2C)Oc2cc(C)ccc21 |
| InChI | InChI=1S/C23H26O/c1-7-22(6)15-23(8-2,19-11-9-16(3)13-18(19)5)24-21-14-17(4)10-12-20(21)22/h7-14H,1-2,15H2,3-6H3 |
| InChIKey | NQKLQEHLPQVJIX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|