C25H29BrClN3O2 — CID 158011192
8-bromo-4-(2-chlorophenyl)-6-[3-(dipropylamino)propyl]pyrrolo[3,4-e]indole-1,3-dione;molecular hydrogen (PubChem CID 158011192) has the molecular formula C25H29BrClN3O2 and a molecular weight of 518.88 g/mol. Its IUPAC name is 8-bromo-4-(2-chlorophenyl)-6-[3-(dipropylamino)propyl]pyrrolo[3,4-e]indole-1,3-dione;molecular hydrogen.
| Compound Name | 8-bromo-4-(2-chlorophenyl)-6-[3-(dipropylamino)propyl]pyrrolo[3,4-e]indole-1,3-dione;molecular hydrogen |
|---|---|
| PubChem CID | 158011192 |
| Molecular Formula | C25H29BrClN3O2 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 8-bromo-4-(2-chlorophenyl)-6-[3-(dipropylamino)propyl]pyrrolo[3,4-e]indole-1,3-dione;molecular hydrogen |
| SMILES | CCCN(CCC)CCCn1cc(Br)c2c3c(c(-c4ccccc4Cl)cc21)C(=O)NC3=O.[H][H] |
| InChI | InChI=1S/C25H27BrClN3O2.H2/c1-3-10-29(11-4-2)12-7-13-30-15-18(26)22-20(30)14-17(16-8-5-6-9-19(16)27)21-23(22)25(32)28-24(21)31;/h5-6,8-9,14-15H,3-4,7,10-13H2,1-2H3,(H,28,31,32);1H |
| InChIKey | FEXFCRJPLUXDBP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|