About [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol
[(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol (PubChem CID 15801209) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol.
Molecular Properties
| Compound Name | [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol |
| PubChem CID | 15801209 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol |
| SMILES | CC1=CCC2C3C(C(C)C)CC[C@@]2(CO)C13 |
| InChI | InChI=1S/C15H24O/c1-9(2)11-6-7-15(8-16)12-5-4-10(3)14(15)13(11)12/h4,9,11-14,16H,5-8H2,1-3H3/t11?,12?,13?,14?,15-/m0/s1 |
| InChIKey | FJQZXWCSOKYVLO-MWHZVNNOSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol?
The IUPAC name of [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol (CID 15801209) is [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol.
What is the SMILES notation for [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol?
The canonical SMILES for [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol is CC1=CCC2C3C(C(C)C)CC[C@@]2(CO)C13.
What is the InChIKey of [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol?
The InChIKey is FJQZXWCSOKYVLO-MWHZVNNOSA-N. The full InChI is InChI=1S/C15H24O/c1-9(2)11-6-7-15(8-16)12-5-4-10(3)14(15)13(11)12/h4,9,11-14,16H,5-8H2,1-3H3/t11?,12?,13?,14?,15-/m0/s1.
What are the key properties of [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol?
[(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol has a molecular weight of 220.36 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-3-methyl-8-propan-2-yl-1-tricyclo[4.4.0.02,7]dec-3-enyl]methanol is sourced from PubChem (CID 15801209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).