About 5-hydroxy-1,3-dimethylquinoxalin-2-one
5-hydroxy-1,3-dimethylquinoxalin-2-one (PubChem CID 15801299) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 5-hydroxy-1,3-dimethylquinoxalin-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-1,3-dimethylquinoxalin-2-one |
| PubChem CID | 15801299 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 5-hydroxy-1,3-dimethylquinoxalin-2-one |
| SMILES | Cc1nc2c(O)cccc2n(C)c1=O |
| InChI | InChI=1S/C10H10N2O2/c1-6-10(14)12(2)7-4-3-5-8(13)9(7)11-6/h3-5,13H,1-2H3 |
| InChIKey | IXULCLXVOCXASM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-1,3-dimethylquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-1,3-dimethylquinoxalin-2-one?
The IUPAC name of 5-hydroxy-1,3-dimethylquinoxalin-2-one (CID 15801299) is 5-hydroxy-1,3-dimethylquinoxalin-2-one.
What is the SMILES notation for 5-hydroxy-1,3-dimethylquinoxalin-2-one?
The canonical SMILES for 5-hydroxy-1,3-dimethylquinoxalin-2-one is Cc1nc2c(O)cccc2n(C)c1=O.
What is the InChIKey of 5-hydroxy-1,3-dimethylquinoxalin-2-one?
The InChIKey is IXULCLXVOCXASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-6-10(14)12(2)7-4-3-5-8(13)9(7)11-6/h3-5,13H,1-2H3.
What are the key properties of 5-hydroxy-1,3-dimethylquinoxalin-2-one?
5-hydroxy-1,3-dimethylquinoxalin-2-one has a molecular weight of 190.20 g/mol, XLogP of 0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-1,3-dimethylquinoxalin-2-one is sourced from PubChem (CID 15801299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).