C14H15F3N4O5 — CID 158013544
methyl (2S)-2-amino-4-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]butanoate;2,2,2-trifluoroacetate (PubChem CID 158013544) has the molecular formula C14H15F3N4O5 and a molecular weight of 376.29 g/mol. Its IUPAC name is methyl (2S)-2-amino-4-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]butanoate;2,2,2-trifluoroacetate.
| Compound Name | methyl (2S)-2-amino-4-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]butanoate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 158013544 |
| Molecular Formula | C14H15F3N4O5 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | methyl (2S)-2-amino-4-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]butanoate;2,2,2-trifluoroacetate |
| SMILES | COC(=O)[C@@H](N)CC[n+]1ccc(-c2ncco2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C12H15N4O3.C2HF3O2/c1-18-12(17)10(13)3-6-16-5-2-9(8-15-16)11-14-4-7-19-11;3-2(4,5)1(6)7/h2,4-5,7-8,10H,3,6,13H2,1H3;(H,6,7)/q+1;/p-1/t10-;/m0./s1 |
| InChIKey | JKNWRIHQGYEWKR-PPHPATTJSA-M |
| XLogP | -0.79 |
| TPSA | 135.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|