C29H62N2 — CID 158014469
N,N'-bis(2,2,5,7-tetramethyloctyl)pentane-1,5-diamine (PubChem CID 158014469) has the molecular formula C29H62N2 and a molecular weight of 438.83 g/mol. Its IUPAC name is N,N'-bis(2,2,5,7-tetramethyloctyl)pentane-1,5-diamine.
| Compound Name | N,N'-bis(2,2,5,7-tetramethyloctyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 158014469 |
| Molecular Formula | C29H62N2 |
| Molecular Weight | 438.83 g/mol |
| Exact Mass | 438.49 |
| IUPAC Name | N,N'-bis(2,2,5,7-tetramethyloctyl)pentane-1,5-diamine |
| SMILES | CC(C)CC(C)CCC(C)(C)CNCCCCCNCC(C)(C)CCC(C)CC(C)C |
| InChI | InChI=1S/C29H62N2/c1-24(2)20-26(5)14-16-28(7,8)22-30-18-12-11-13-19-31-23-29(9,10)17-15-27(6)21-25(3)4/h24-27,30-31H,11-23H2,1-10H3 |
| InChIKey | MFCCWGFPALOZFU-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.83 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|