C42H31Br2ClN8 — CID 158016423
4-bromoaniline;N-(4-bromophenyl)-4,6-diphenyl-1,3,5-triazin-2-amine;2-chloro-4,6-diphenyl-1,3,5-triazine (PubChem CID 158016423) has the molecular formula C42H31Br2ClN8 and a molecular weight of 843.03 g/mol. Its IUPAC name is 4-bromoaniline;N-(4-bromophenyl)-4,6-diphenyl-1,3,5-triazin-2-amine;2-chloro-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 4-bromoaniline;N-(4-bromophenyl)-4,6-diphenyl-1,3,5-triazin-2-amine;2-chloro-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 158016423 |
| Molecular Formula | C42H31Br2ClN8 |
| Molecular Weight | 843.03 g/mol |
| Exact Mass | 840.07 |
| IUPAC Name | 4-bromoaniline;N-(4-bromophenyl)-4,6-diphenyl-1,3,5-triazin-2-amine;2-chloro-4,6-diphenyl-1,3,5-triazine |
| SMILES | Brc1ccc(Nc2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1.Clc1nc(-c2ccccc2)nc(-c2ccccc2)n1.Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H15BrN4.C15H10ClN3.C6H6BrN/c22-17-11-13-18(14-12-17)23-21-25-19(15-7-3-1-4-8-15)24-20(26-21)16-9-5-2-6-10-16;16-15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12;7-5-1-3-6(8)4-2-5/h1-14H,(H,23,24,25,26);1-10H;1-4H,8H2 |
| InChIKey | FFNGSELETNNCHH-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.03 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|